how to balance CCl4+Fe(0)=CH2Cl2+Cl(-)+Fe(2+)?

Fe^0 means that the iron is elemental, without a charge

CCl4 + Fe --> CH2Cl2 + Fe2+ + Cl-

first of all, there is no H2 as a reactant but there is hydrogen in the products. therefore, you can either say that this is a non-reaction or we can do it as a redox reaction which will add H+ and H2O to the reaction as a whole

C in CCl4 = 4+ and becomes 0 in CH2Cl2, gained 4 e-

Fe is neutral and becomes 2+, loses 2 e-

Cl oxidation state doesn't change

CCl4 + 4e- + 2H+ --> CH2Cl2 + 2Cl-

Fe --> Fe2+ + 2e-

CCl4 + 4e- + 2H+ --> CH2Cl2 + 2Cl-

2Fe --> 2Fe2+ + 4e-

combine and elminate

CCl4 + 2H+ + 2Fe --> CH2cl2 + 2Cl- + 2Fe2+